|
|
Drugs for Corticobasal Degeneration (from DrugBank, HMDB, Dgidb, PharmGKB, IUPHAR, NovoSeek, BitterDB): (show all 25)
| id | | Name | Status | Phase | Clinical Trials | Cas Number | PubChem Id |
|---|
| 1 | | cadexomer iodine | | Phase 4 | 537 | | | | 2 | | Pharmaceutical Solutions | | Phase 4 | 8192 | | | | 3 | | Iodine | | Phase 4 | 570 | 7553-56-2 | 807 | | Iodio Iodum Jod Jood Tincture iodine |
| | 4 | | Calamus | Nutraceutical | Phase 4 | 459 | | | | 5 | | Vitamins | | Phase 2, Phase 3 | 5282 | | | | 6 | | Ubiquinone | | Phase 2, Phase 3 | 145 | | | | 7 | | Trace Elements | | Phase 2, Phase 3 | 6001 | | | | 8 | | Micronutrients | | Phase 2, Phase 3 | 6001 | | | | 9 | | Coenzyme Q10 | experimental, Nutraceutical | Phase 2, Phase 3 | 121 | 303-98-0 | 5281915 | (all-E)-2,3-dimethoxy-5-methyl-6-(3,7,11,15,19,23,27,31-octamethyl-2,6,10,14,18,22,26,30-dotriacontaoctaenyl)-2,5-Cyclohexadiene-1,4-dione (all-E)-2-(3,7,11,15,19,23,27,31,35,39-decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaenyl)-5,6-dimethoxy-3-methyl-2,5-Cyclohexadiene-1,4-dione 2-(3,7,11,15,19,23,27,31,35,39-Decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaenyl)-5,6-dimethoxy-3-methyl-p-Benzoquinone 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-Decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaenyl]-5,6-dimethoxy-3-methyl- 2,5-Cyclohexadiene-1,4-dione 4-Ethyl-5-fluoropyrimidine Aqua Q 10L10 Aqua Q10 Bio-Quinon Bio-Quinone Q10 CoQ10 Coenzyme Q-10 Coenzyme Q10 Ensorb Kaneka Q10 | Kudesan Li-Q-Sorb Liquid-Q Neuquinon Neuquinone PureSorb Q 40 Q 10AA Q-Gel Q-Gel 100 Ubidecarenone Ubiquinone 10 Ubiquinone 50 Ubiquinone Q10 Ubiquinone-10 Unbiquinone Unispheres Q 10 |
| | 10 | | Tranquilizing Agents | | Phase 1, Phase 2 | 4265 | | | | 11 | | Radiopharmaceuticals | | Phase 2 | 514 | | | | 12 | | Psychotropic Drugs | | Phase 1, Phase 2 | 6430 | | | | 13 | | Fluorodeoxyglucose F18 | | Phase 2 | 412 | | | | 14 | | Lithium carbonate | | Phase 1, Phase 2 | 240 | 554-13-2 | | | 15 | | Antidepressive Agents | | Phase 1, Phase 2 | 2736 | | | | 16 | | Antimanic Agents | | Phase 1, Phase 2 | 814 | | | | 17 | | Central Nervous System Depressants | | Phase 1, Phase 2 | 13403 | | | | 18 | | taxane | | Phase 1 | 354 | | | | 19 | | Pramipexole | approved, investigational | | 139 | 104632-26-0 | 59868, 119570 | (-)-Pramipexole (6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (6S)-N(6)-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (6S)-N6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (S)-2-Amino-4,5,6,7-tetrahydro-6-(propylamino)benzothiazole (S)-N 6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine 104632-26-0 111GE001 2-amino-4,5,6,7-tetrahydro-6-propylaminobenzothiazole 2-amino-6-propylaminotetrahydrobenzothiazole AC1L3P1T BIDD:GT0250 C10H17N3S CHEBI:8356 CHEMBL301265 CID119570 CPD000449298 D05575 DivK1c_006916 Furfuryl Acetate HMS2051A21 HMS2090C15 KBio1_001860 KBio2_002340 KBio2_004908 | KBio2_007476 KBioSS_002343 LS-40722 MLS000758250 MLS001423952 Mirapex MolPort-003-849-957 NCGC00167441-01 Pramipexol Pramipexol [Spanish] Pramipexole Pramipexole (USAN/INN) Pramipexole 2HCl Monohydrate Pramipexole [USAN:INN] Pramipexole hydrochloride Pramipexolum Pramipexolum [Latin] SAM001247006 SBB070477 SMR000449298 SND-919 SUD919CL2Y SpecPlus_000820 Spectrum5_001453 Spectrum_001838 U-98528E pramipexole |
| | 20 | | Levodopa | approved | | 402 | 59-92-7 | 6047 | (-)-(3,4-Dihydroxyphenyl)alanine (-)-3-(3,4-Dihydroxyphenyl)-L-alanine (-)-3-(3,4-dihydroxyphenyl)-L-alanine (-)-Dopa (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid (−)-3-(3,4-dihydroxyphenyl)-L-alanine (−)-dopa .Beta.-(3, 4-Dihydroxyphenyl)alanine .Beta.-(3,4-Dihydroxyphenyl)-L-alanine 1E83F927-C221-46AA-B90A-81B33C5F3868 2-Amino-3-(3,4-dihydroxyphenyl)propanoic acid 23734-74-9 25525-15-9 3, 4-Dihydroxy-L-phenylalanine 3, 4-Dihydroxyphenylalanine 3,4-DIHYDROXYPHENYLALANINE 3,4-Dihydroxy-L-phenylalanine 3,4-Dihydroxyphenyl-L-alanine 3,4-Dihydroxyphenylalanine 3,4-Dihydroxyphenylalanine (VAN) 3,4-dihydroxy-L-phenylalanine 3,4-dihydroxyphenylalanine 3-(3,4-Dihydroxypheny 3-(3,4-Dihydroxyphenyl)-L-alanine 3-Hydroxy-L-tyrosine 34241-25-3 37830_FLUKA 587-45-1 59-92-7 72572-99-7 72573-00-3 88250-23-1 90638-38-3 AC-11686 AC1L1LOR AC1Q4U7F BIDD:GT0158 BPBio1_000059 BSPBio_000053 BSPBio_002354 Bendopa Bio-0575 Biodopa Brocadopa C00355 C9H11NO4 CAS-59-92-7 CCRIS 3766 CHEBI:15765 CHEMBL1009 CID6047 Cerepap Cidandopa D 9628 D00059 D0600 D9628 D9628_SIGMA DAH DB01235 DOPA Deadopa Dihydroxy-L-phenylalanine Dihydroxyphenylalanine DivK1c_000452 Dopa Dopaflex Dopaidan Dopal Dopal-Fher Dopal-fher Dopalina Dopar Dopar (TN) Doparkine Doparl Dopasol Dopaston Dopaston SE Dopastone Dopastral Dopicar Doprin EINECS 200-445-2 EU-0100454 Eldopal Eldopar Eldopatec Eurodopa HMS1568C15 HMS1922J14 HMS2090O08 HMS2093N04 HMS501G14 HSDB 3348 Helfo DOPA | Helfo-Dopa Helfo-dopa IDI1_000452 IV Levodopa InChI=1/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14 Insulamina KBio1_000452 KBio2_000934 KBio2_003502 KBio2_006070 KBioGR_001177 KBioSS_000934 L Dopa L(-)-Dopa L-(-)-Dopa L-(3, 4-Dihydroxyphenyl)-.alpha.-alani L-(3, 4-Dihydroxyphenyl)alanine L-(o-Dihydroxyphenyl)alanine L-.Beta.-(3,4-Dihydroxyphenyl)alanine L-3,4-Dihydroxyphenylalanine L-3,4-dihydroxyphenylalanine L-3-(3,4-Dihydroxyphenyl)-Alanine L-3-(3,4-Dihydroxyphenyl)alanine L-3-Hydroxytyrosine L-4-5-Dihydroxyphenylalanine L-DOPA L-DOPA, Parcopa, Atamet, Stalevo, Madopar, Prolopa, Dopar, 3,4-Dihydroxyphenylalanine, Levodopa L-Dihydroxyphenylalanine L-Dopa L-O-Dihydroxyphenylalanine L-b-(3,4-Dihydroxyphenyl)-a-alanine L-beta-(3,4-Dihydroxyphenyl)-alpha-alanine L-beta-(3,4-Dihydroxyphenyl)alanine L-o-Hydroxytyrosine LS-255 Laradopa Larodopa Ledopa Levedopa Levodopa Levodopa (JP15/USP) Levodopa (JP15/USP/INN) Levodopa [USAN:INN:BAN:JAN] Levodopum Levodopum [INN-Latin] Levopa Lopac-D-9628 Lopac0_000454 MLS000028514 Maipedopa MolPort-000-856-937 NCGC00015384-01 NCGC00016270-01 NCGC00016270-06 NCGC00093869-04 NINDS_000452 NSC 118381 NSC118381 PDSP1_001541 PDSP2_001525 Parda Pardopa Prestwick0_000017 Prestwick1_000017 Prestwick2_000017 Prestwick3_000017 Prestwick_185 Prodopa Ro 4-6316 S1726_Selleck SDCCGMLS-0066924.P001 SMR000058312 SPBio_000391 SPBio_001974 SPECTRUM2300205 Sobiodopa Spectrum2_000496 Spectrum4_000539 Spectrum5_001899 Spectrum_000454 Syndopa UNII-46627O600J Veldopa Weldopa b-(3,4-Dihydroxyphenyl)-L-alanine b-(3,4-Dihydroxyphenyl)-a-L-alanine b-(3,4-Dihydroxyphenyl)alanine beta-(3,4-Dihydroxyphenyl)-L-alanine beta-(3,4-Dihydroxyphenyl)-alpha-L-alanine beta-(3,4-Dihydroxyphenyl)-alpha-alanine beta-(3,4-Dihydroxyphenyl)alanine bmse000322 component of Sinemet l)-L-alanine nchembio.2007.55-comp26 nchembio.89-comp9 ne β-(3,4-dihydroxyphenyl)alanine | |
| | 21 | | Ropinirole | approved, investigational | | 74 | 91374-20-8, 91374-21-9 | 5095, 497540 | 1,3-Dihydro-4-(2-(dipropylamino)ethyl)-2H-indol-2-one monohydrochloride 2(H)-Indol-2-one, 4-(2-(dipropylamino)ethyl)-1,3-dihydro-, monohydrochloride 2H-Indol-2-one, 1,3-dihydro-4-(2-(dipropylamino)ethyl)-, monohydrochloride 2H-Indol-2-one, 4-[2-(dipropylamino)ethyl]-1,3-dihydro-, hydrochloride (1:1) 4-(2-(Dipropylamino)ethyl)-2-indolinone monohydrochloride 4-[2-(Dipropylamino)ethyl]-1,3-dihydro-2H-indol-2-one 4-[2-(Dipropylamino)ethyl]indoline-2-one 4-[2-(dipropylamino)ethyl]-1,3-dihydro-2H-indol-2-one hydrochloride 4-[2-(dipropylamino)ethyl]-1,3-dihydroindol-2-one 4-[2-(dipropylamino)ethyl]-1,3-dihydroindol-2-one hydrochloride 91374-20-8 91374-20-8 (hydrochloride) 91374-21-9 91374-21-9 (Parent) AB1004799 AC-735 AC1L1JLL AC1L2ABS AC1Q3EQJ AR-1L3132 Adartrel BIDD:GT0826 BRD-K15933101-003-01-2 C07564 CHEBI:8888 CHEMBL1200411 CHEMBL589 CID5095 CID68727 D00784 D08489 DB00268 EU-0101101 HMS2093K04 I06-0692 I06-0693 JZP-7 L000520 LS-83828 LS-83890 Lopac-R-4152 Lopac0_001101 | MolPort-003-666-598 MolPort-003-987-439 NCGC00015893-01 NCGC00015893-04 NCGC00094373-01 NCGC00096064-01 NCGC00096064-02 NVD-434 R 4152 ReQuip ReQuip CR ReQuip LP ReQuip XL ReQuip XR Repreve Requip (TN) Ropinirol Ropinirol [INN-Spanish] Ropinirole Ropinirole (INN) Ropinirole HCl Ropinirole [INN:BAN] Ropinirole hydrochloride Ropinirole hydrochloride (JAN/USAN) Ropinirole hydrochloride [USAN] Ropinirolum Ropinirolum [INN-Latin] Ropitor Ropitor (TN) SK&F 101468 SK&F 101468-A SK&F-101,468 SK&F-101468-A SK&F-101468A SKF 101468 SKF 101468-A SPECTRUM1505178 ST51051236 TL8005858 TL8005859 UNII-030PYR8953 UNII-D7ZD41RZI9 ropinirol | |
| | 22 | | Carbidopa | approved | | 184 | 28860-95-9 | 34359, 38101 | (-)-L-alpha-Hydrazino-3,4-dihydroxy-alpha-methylhydrocinnamic acid (-)-L-alpha-Hydrazino-3,4-dihydroxy-alpha-methylhydrocinnamic acid monohydrate (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazino-2-methylpropanoic acid (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid hydrate (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid monohydrate (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid--water (1/1) (S)-(-)-carbidopa (S)-(-)-carbidopa hydrate (S)-(−)-carbidopa (S)-alpha--Hydrazino-3,4-dihydroxy-alpha--methyl-benzenepropanoic acid monohydrate (S)-carbidopa (S)-carbidopa hydrate (alphaS)-alpha-hydrazino-3,4-dihydroxy-alpha-methylbenzenepropanoic acid (alphaS)-alpha-hydrazino-3,4-dihydroxy-alpha-methylbenzenepropanoic acid monohydrate (αS)-α-hydrazino-3,4-dihydroxy-α-methylbenzenepropanoic acid 27925-91-3 28860-95-9 31823-41-3 38821-49-7 AC-1676 AC1L1RFR AC1L1Z32 AC1Q5QGW Atamet BB_SC-5095 Benzenepropanoic acid, alpha-hydrazino-3,4-dihydroxy-alpha-methyl-, monohydrate, (S) C-126 C-DOPA C126_SIGMA C1335_SIGMA CCRIS 5093 CHEBI:3395 CHEBI:39585 CHEMBL1200748 CHEMBL1201236 CID34359 CID38101 CPD-11550 Carbidopa (anhydrous) Carbidopa Anhydrous Carbidopa Monohydrate Carbidopa [USAN:INN:BAN] Carbidopa anhydrous Carbidopa hydrate Carbidopa, (S)-Isomer Carbidopa, Entacapone, & Levodopa Carbidopa-1-wasser | Carbidopum Carbidopum [INN-Latin] DB00190 EINECS 249-271-9 EU-0100382 HMS2089B12 Hadrazino-alpha-methyldopa Hydrocinnamic acid, (-)-L-alpha-hydrazino-3,4-dihydroxy-alpha-methyl-, monohydrate KINSON, 3-(3,4-DIHYDROXY-PHENYL)-2-HYDRAZINO-2-METHYL-PROPIONIC ACID L-3-(3,4-Dihydroxyphenyl)-2-methyl-2-hydrazinopropionic acid L-3-(3,4-dihydroxyphenyl)-2-methyl-2-hydrazinopropionic acid L-alpha-(3,4-dihydroxybenzyl)-alpha-hydrazinopropionic acid monohydrate L-alpha-Methyl-alpha-hydrazino-beta-(3,4-dihydroxyphenylpropionic acid L-alpha-Methyl-beta-(3,4-dihydroxyphenyl)-alpha-hydrazinopropionic acid L-alpha-Methyldopahydrazine L-α-methyldopahydrazine LS-77199 Lodosin Lodosyn Lodosyn, Carbidopa Lopac0_000382 MK 486 MK-485 MK-486 MLS000069628 MLS002207014 Methyldopahydrazine MolPort-003-940-629 MolPort-005-934-181 N-Aminomethyldopa NCGC00024596-01 NCGC00024596-03 NCGC00024596-05 NCGC00024596-06 S(-)-CARBIDOPA S(-)-alpha-Hydrazino-3,4-dihydroxy-alpha-methylhydrocinnamic acid monohydrate S-(-)-Carbidopa S-(-)-alpha-Hydrazino-3,4-dihydroxy-2-methylbenzenepropanoic acid S1891_Selleck SMP1_000057 SMR000058235 ST055523 Stalevo Tocris-0455 UNII-KR87B45RGH UNII-MNX7R8C5VO alpha-Hydrazino-alpha-methyl-beta-(3,4-dihydroxyphenyl)propionic acid alpha-Methyldopahydrazine carbidopa carbidopum monohydricum |
| | 23 | | Entacapone | approved, investigational | | 54 | 130929-57-6 | 5281081 | (2E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide (E)-2-Cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide (E)-2-cyano-3-(3,4-dihydroxy-5-nitro-phenyl)-N,N-diethyl-prop-2-enamide (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide (E)-alpha-Cyano-N,N-diethyl-3,4-dihydroxy-5-nitrocinnamamide (e)-alpha-Cyano-N,N-diethyl-3,4-dihydroxy-5-nitrocinnamamide 116314-67-1 130929-57-6 2-Cyano-N,N-diethyl-3-(3,4-dihydroxy-5-nitrophenyl)propenamide AC-393 AC1NQY02 BIDD:GT0026 C071192 C07943 C14H15N3O5 CHEBI:4798 CHEMBL953 CID5281081 COM-998 Comtan Comtan (TN) Comtess D00781 | DB00494 ENTACAPONE Entacapona Entacapona [INN-Spanish] Entacapone Entacapone (JAN/USAN/INN) Entacapone [USAN:INN] Entacapone [Usan:Inn] Entacaponum Entacaponum [INN-Latin] HMS2089O16 KB475572 LS-123327 LS-172316 MolPort-003-847-054 N,N-Diethyl-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl) acrylamide N,N-diethyl-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl) acrylamide NCGC00164555-01 Novartis brand of entacapone OR 611 OR-611 Orion brand of entacapone UNII-4975G9NM6T entacapone | |
| | 24 | | Amantadine | approved | | 67 | 768-94-5 | 2130 | 1-Adamantamine 1-Adamantanamine 1-Adamantanamine (8CI) 1-Adamantylamine 1-Aminoadamantane 1-Aminotricyclo(3.3.1.1(sup 3,7))decane 1-adamantanamine 1-adamantylamine 1-aminoadamantane 138576_ALDRICH 665-66-7 (hydrochloride) 768-94-5 AB00514655 AC-11992 AC1L1CZI AC1Q4UAF AC1Q5396 ADAMANTANE,1-AMINO AKOS000113994 AKOS000119324 Adamantamine Adamantanamine Adamantylamine Amant Amantadina Amantadina [INN-Spanish] Amantadine Amantadine (INN) Amantadine Base Amantadine HCL Amantadine Hydrochloride Amantadine [INN:BAN] Amantadinum Amantadinum [INN-Latin] Amantidine Ambap768-94-5 Aminoadamantane BIA4304 BIDD:GT0757 BPBio1_000368 BRN 2204333 BSPBio_000334 BSPBio_001570 BSPBio_001822 Bio-0821 C06818 C10H17N CHEBI:2618 CHEMBL660 CID2130 D07441 DB00915 DivK1c_000815 EINECS 212-201-2 Endantadine Gen-Amantadine HMS1791O12 HMS1989O12 HSDB 3202 I14-1101 IDI1_000815 InChI=1/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H KBio1_000815 KBio2_000390 | KBio2_002958 KBio2_005526 KBio3_001322 KBioGR_000548 KBioSS_000390 L000868 LS-157049 Lopac-A-1260 Lopac0_000004 Mantadine MolPort-001-661-700 MolPort-001-760-587 MolPort-001-791-102 NCGC00015036-01 NCGC00015036-07 NCGC00162039-01 NCGC00162039-02 NCGC00162039-03 NCGC00162039-04 NCGC00179597-01 NCIOpen2_001059 NINDS_000815 NSC 341865 NSC341865 NSC83653 OR14310 Oprea1_248648 Pk-Merz Pk-merz Prestwick0_000407 Prestwick1_000407 Prestwick2_000407 Prestwick3_000407 SPBio_000002 SPBio_002273 STK298781 Spectrum2_000081 Spectrum3_000291 Spectrum4_000134 Spectrum5_000772 Spectrum_000030 Symadine Symmetrel TCMDC-125869 TL8005280 Tricyclo(3.3.1.1(3,7))-decan-1-amine Tricyclo(3.3.1.1(sup 3,7))decan-1-amine Tricyclo(3.3.1.1(sup 3.7))decan-1-amine Tricyclo(3.3.1.13,7)decan-1-amine Tricyclo[3.3.1.1(3,7)]decan-1-amine Tricyclo[3.3.1.1(3,7)]decan-1-ylamine Tricyclo[3.3.1.1(3,7)]decane-1-amine Tricyclo[3.3.1.1(sup3,7)]decan-1-amine Tricyclo[3.3.1.1^3,7]decan-1-amine UNII-BF4C9Z1J53 Viregyt Virosol WLN: L66 B6 A B- C 1B ITJ BZ Wiregyt adamantan-1-amine adamantan-1-ylamine amantadine amantadine hydrochloride tricyclo[3.3.1.1(3,7)]decan-1-ylamine tricyclo[3.3.1.1(3,7)]decane-1-amine tricyclo[3.3.1.1~3,7~]decan-1-amine |
| | 25 | | Vaccines | | | 6611 | | |
Interventional clinical trials: (show all 29)
| id | Name | Status | NCT ID | Phase |
|---|
| 1 | DaTSCAN Imaging in Aging and Neurodegenerative Disease | Enrolling by invitation | NCT01453127 | Phase 4 | | 2 | Effects of Coenzyme Q10 in PSP and CBD | Completed | NCT00532571 | Phase 2, Phase 3 | | 3 | A Pilot Trial of Lithium in Subjects With Progressive Supranuclear Palsy or Corticobasal Degeneration | Completed | NCT00703677 | Phase 1, Phase 2 | | 4 | Electrical Polarization of the Brain in Corticobasal Syndrome | Completed | NCT00273897 | Phase 2 | | 5 | The Differential Diagnosis of Parkinson's Disease and Parkinsonism by Positron-emission Tomography | Completed | NCT01824056 | Phase 2 | | 6 | Davunetide (AL-108) in Predicted Tauopathies - Pilot Study | Active, not recruiting | NCT01056965 | Phase 2 | | 7 | Tau Imaging in Subjects With Progressive Supranuclear Palsy, Corticobasal Degeneration and Healthy Volunteers | Completed | NCT02167594 | Phase 1 | | 8 | Safety Study of TPI-287 to Treat CBS and PSP | Active, not recruiting | NCT02133846 | Phase 1 | | 9 | Innovative Biomarkers in Alzheimer's Disease and Frontotemporal Dementia (FTD): Preventative and Personalized | Unknown status | NCT01403519 | | | 10 | The Sunnybrook Dementia Study: Mapping Brain Changes in Alzheimer's, Vascular and Other Dementias | Unknown status | NCT01800214 | | | 11 | Repetitive Transcranial Magnetic Stimulation (TMS) for Progressive Supranuclear Palsy and Corticobasal Degeneration | Completed | NCT01174771 | | | 12 | Study of Tongue Pressures | Completed | NCT00013832 | | | 13 | PROgressive Supranuclear Palsy CorTico-Basal Syndrome Multiple System Atrophy Longitudinal Study UK | Recruiting | NCT02778607 | | | 14 | 4-Repeat Tauopathy Neuroimaging Initiative - Cycle 2 | Recruiting | NCT02966145 | | | 15 | Advancing Research and Treatment for Frontotemporal Lobar Degeneration (ARTFL) | Recruiting | NCT02365922 | | | 16 | More Than a Movement Disorder: Applying Palliative Care to Parkinson's Disease | Recruiting | NCT03076671 | | | 17 | Parkinson's Disease, Diagnostic Observations (PADDO) | Recruiting | NCT01249768 | | | 18 | Gait Analysis in Neurological Disease | Recruiting | NCT02994719 | | | 19 | Defining Phenotypes of Movement Disorders :Parkinson's Plus Disorders (PD), Essential Tremor (ET), Cortical Basal Degeneration (CBD), Multiple Systems Atrophy (MSA), Magnetoencephalography. | Recruiting | NCT02132052 | | | 20 | ADDIA Proof-of-Performance Clinical Study | Recruiting | NCT03030586 | | | 21 | Positron Emission Tomography (PET) Imaging of Tau Pathology in Neurodegenerative Disease | Recruiting | NCT03143374 | | | 22 | The Swedish BioFINDER 2 Study | Recruiting | NCT03174938 | | | 23 | Diagnosing Frontotemporal Lobar Degeneration | Recruiting | NCT02964637 | | | 24 | Genetic Characterization of Movement Disorders and Dementias | Recruiting | NCT02014246 | | | 25 | Early-onset Alzheimer's Disease Phenotypes: Neuropsychology and Neural Networks | Recruiting | NCT03153371 | | | 26 | 4 Repeat Tauopathy Neuroimaging Initiative | Active, not recruiting | NCT01804452 | | | 27 | Study for the Early Diagnosis of Parkinson's Disease | Active, not recruiting | NCT02283073 | | | 28 | Vaccination Uptake (VAX) in PD | Not yet recruiting | NCT02874274 | | | 29 | SudoScan as a Biomarker of Parkinson's Disease | Not yet recruiting | NCT02767037 | |
|
