|
|
Drugs for Hypertrophic Pyloric Stenosis (from DrugBank, HMDB, Dgidb, PharmGKB, IUPHAR, NovoSeek, BitterDB): (show all 11)
| id | | Name | Status | Phase | Clinical Trials | Cas Number | PubChem Id |
|---|
| 1 | | Epinephrine | approved, vet_approved | | 985 | 51-43-4 | 5816 | (-)-(R)-Epinephrine (-)-3,4-Dihydroxy-a-[2-(methylamino)ethyl]benzyl alcohol (-)-3,4-Dihydroxy-alpha-((methylamino)methyl)benzyl alcohol (-)-3,4-Dihydroxy-alpha-[2-(methylamino)ethyl]benzyl alcohol (-)-3,4-dihydroxy-a-[(methylamino)methyl]-Benzyl alcohol (-)-3,4-dihydroxy-alpha-[(methylamino)methyl]-Benzyl alcohol (-)-Adrenalin (-)-Adrenaline (-)-Epinephrine (-)-R-Epinephrine (R)-(-)-Adnephrine (R)-(-)-Adrenaline (R)-(-)-Epinephrine (R)-(-)-Epirenamine (R)-(−)-adrenaline (R)-4-[1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol (R)-4-[1-hydroxy-2-(methylamino)ethyl]-1,2-Benzenediol (R)-Adrenaline (R)-Epinephrine (−)-adrenaline 02252_FLUKA 1-1-(3,4-Dihydroxyphenyl)-2-methylaminoethanol 1-Adrenalin 1-Epinephrine 4-(1-Hydroxy-2-(methylamino)ethyl)-1,2-benzenediol 4-(1-hydroxy-2-methylamino-ethyl)benzene-1,2-diol 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-Benzenediol 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol 51-43-4 51-43-4 (FREE BASE) 51028-73-0 A0173 AC-13188 AC1L1L7B ADR ADRENALINE ADROP AI3-19015 Adnephrine Adrenal Adrenalin Adrenalin (TN) Adrenalin in Oil Adrenalin-Medihaler Adrenalina Adrenalina [DCIT] Adrenaline Adrenaline (JP15) Adrenaline/Epinephrine Adrenalinum Adrenamine Adrenan Adrenapax Adrenasol Adrenatrate Adrenine Adrenodis Adrenohorma Adrenosan Adrenutol Adrin Adrine Ana-Guard Ana-Kit Antiasthmatique Asmatane Mist Asthma meter mist Asthma-nefrin Asthmahaler Mist Asthmanefrin Astmahalin Astminhal BIDD:GT0119 Balmadren Bernarenin Biorenine Bosmin Brevirenin Bronkaid Bronkaid Mist Bronkaid Suspension Mist Bupivacaine Hcl and Epinephrine C00788 CCRIS 4812 CHEBI:28918 CHEMBL679 CID5816 Chelafrin Citanest Forte Corisol D-Epifrin D-Epinephrine D00095 DB00668 Drenamist Dylephrin Dyspne-Inhal E4250_SIGMA EINECS 200-098-7 EPI E Z PEN JR EPIPEN E Z PEN EPIPEN JR Epi EZ Pen Jr Epifrin Epiglaufrin Epinefrin Epinefrin [Czech] Epinefrina Epinefrina [INN-Spanish] Epinephran Epinephrin Epinephrine Epinephrine (USP) Epinephrine (USP/INN) Epinephrine [USAN:INN:JAN] Epinephrine hydrochloride Epinephrinum Epinephrinum [INN-Latin] Epipen Epipen (TN) Epipen Auto-Injector Epipen EZ Pen Epipen Jr. Epipen Jr. Auto-Injector Epirenamine Epirenan Epirenin Epitrate Eppy Esphygmogenina Exadrin | Glaucon Glaucosan Glauposine Glycirenan HSCI1_000215 HSDB 4289 Haemostasin Haemostatin Hektalin Hemisine Hemostasin Hemostatin Hypernephrin Hyporenin IOP Intranefrin Iontocaine Isoptoepinal Kidoline L-1-(3,4-Dihydroxyphenyl)-2-methylaminoethanol L-Adrenaline L-Adrenaline Base L-Epinehphrine L-Epinephrine L-Epirenamine L-Methylaminoethanolcatechol L-epinephrine LS-156 Levo-Methylaminoethanolcatechol Levoadrenaline Levoepinephrine Levorenen Levorenin Levorenine Levoreninum Lopac-E-4642 Lyodrin Lyophrin Medihaler-Epi Metanephrin Methylaminoethanolcatechol Methylarterenol Micronefrin Micronephrine MolPort-002-051-368 Mucidrina Myosthenine Mytrate NCGC00015417-01 NCGC00142615-01 NCGC00142615-03 NCGC00142615-04 NCGC00142615-05 NCGC00142615-06 NCGC00142615-07 NSC 62786 NSC62786 Nephridine Nieraline PDSP1_001120 PDSP2_001104 Paranephrin Primatene Primatene Mist R-(-)-Epinephrine R-Adrenaline RCRA waste no. P042 Racemic Epinephrine Racepinephrine Rcra waste number P042 Renagladin Renaglandin Renaglandulin Renaleptine Renalina Renoform Renostypricin Renostypticin Renostyptin SMP1_000227 ST069368 SUS-PHRINE SULFITE-FREE Scurenaline Septocaine Simplene Sindrenina Soladren Sphygmogenin Stryptirenal Styptirenal Supracapsulin Supradin Supranefran Supranephrane Supranephrine Supranol Suprarenaline Suprarenin Suprel Surenine Surrenine Sus-Phrine Sus-phrine Susphrine Sympathin I Takamina Takamine Tokamina Tonogen Twinject Twinject 0.15 Twinject 0.3 Twinject 0.30 UNII-YKH834O4BH Vaponefrin Vasoconstrictine Vasoconstrictor Vasodrine Vasoton Vasotonin adrenaline bmse000316 d-Adrenaline epinephrine l-1-(3,4-Dihydroxyphenyl)-2-methylaminoethanol l-Adrenalin l-Adrenaline l-Epinephine l-Epinephrine (synthetic) l-Epirenamine l-Methylaminoethanolcatechol levoepinephrine nchembio747-comp9 |
| | 2 | | Fentanyl | approved, illicit, investigational, vet_approved | | 821 | 437-38-7 | 3345 | 1-Phenethyl-4-(N-phenylpropionamido)piperidine 1-Phenethyl-4-N-propionylanilinopiperidine 1-phenethyl-4-N-propionylanilinopiperidine 437-38-7 5-22-08-00049 (Beilstein Handbook Reference) 80832-90-2 990-73-8 (citrate) AC1L1FQ2 Actiq BIDD:GT0555 BRN 0494484 CHEBI:119915 CHEMBL596 CID3345 D00320 DB00813 Duragesic Duragesic (TN) Duragesic-100 Duragesic-12 Duragesic-25 Duragesic-50 Duragesic-75 Durogesic EINECS 207-113-6 Fentanest Fentanil Fentanil [DCIT] Fentanila Fentanila [INN-Spanish] Fentanilo Fentanyl Fentanyl (JAN/USAN/INN) Fentanyl CII Fentanyl [INN:BAN] Fentanyl citrate Fentanyl-100 Fentanyl-12 Fentanyl-25 | Fentanyl-50 Fentanyl-75 Fentanylum Fentanylum [INN-Latin] HSDB 3329 IONSYS JNS020QD L001275 LS-124439 Matrifen MolPort-003-847-369 N-(1-Phenethyl-4-piperidinyl)-N-phenylpropionamide N-(1-Phenethyl-4-piperidyl)propionanilide N-(1-Phenethyl-piperidin-4-yl)-N-phenyl-propionamide N-(1-Phenethylpiperidin-4-yl)-N-phenylpropionamide N-(1-phenethyl-4-piperidinyl)-N-phenylpropionamide N-(1-phenethyl-4-piperidyl)propionanilide N-(1-phenethylpiperidin-4-yl)-N-phenylpropanamide N-(1-phenethylpiperidin-4-yl)-N-phenylpropionamide N-Phenethyl-4-(N-propionylanilino)piperidine N-Phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide N-phenethyl-4-(N-propionylanilino)piperidine N-phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide NCGC00168252-01 Nasalfent Oprea1_152073 Oprea1_207148 PDSP1_000860 PDSP2_000846 Pentanyl Phentanyl Propanamide, N-phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)- (9CI) R 4263 Rapinyl Sentonil Sublimase Sublimaze UNII-UF599785JZ fentanyl | |
| | 3 | | Propofol | approved, investigational, vet_approved | | 1082 | 2078-54-8 | 4943 | 2, 6-Diisopropylphenol 2,6 Diisopropylphenol 2,6-Bis(1-methylethyl)phenol 2,6-Bis(Isopropyl)-phenol 2,6-DIISOPROPYLPHENOL 2,6-Diisopropyl phenol 2,6-Diisopropylphenol 2,6-bis(1-methylethyl)-phenol 2,6-di(propan-2-yl)phenol 2078-54-8 28449-97-0 4-06-00-03435 (Beilstein Handbook Reference) 50356-15-5 AB00513968 AC-2038 AC1L1J9Y AC1Q1OUI AI3-26295 AM-149 Abbott Brand of Propofol Alpha Brand of Propofol Ampofol Aquafol Astra Brand of Propofol AstraZeneca Brand of Propofol BIDD:GT0436 BPBio1_000950 BPBio1_000969 BRD-K82255054-001-03-5 BRN 1866484 BSPBio_000862 Biomol-NT_000248 Braun Brand of Propofol C07523 C12H18O CAS-2078-54-8 CCRIS 9000 CHEBI:44915 CHEMBL526 CID4943 CPD-11437 CPD000059151 Curamed Brand of Propofol D00549 D015742 D0617 D126608 D126608_ALDRICH DB00818 DDS-04F Diisopropylphenol Dipravan Diprivan Diprivan (TN) Diprivan Injectable emulsion Disoprivan Disoprofol EINECS 218-206-6 EU-0100437 Fresenius Brand of Propofol Fresenius Kabi Brand of Propofol Fresofol HMS1570L04 HMS2089O21 HMS2094E17 | HSDB 7123 ICI 35,868 ICI 35868 ICI-35,868 ICI-35868 ICI35,868 ICI35868 InChI=1/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H Ivofol Jsp004266 Juste Brand of Propofol LS-996 Lopac-D126608 Lopac0_000437 MLS001066348 MLS001335999 MLS002454360 MolPort-001-794-517 NCGC00015389-01 NCGC00015389-02 NCGC00015389-04 NCGC00015389-09 NCGC00091538-01 NCGC00091538-02 NCGC00091538-03 NCGC00091538-04 NCGC00091538-05 NCGC00091538-06 NSC 5105 NSC5105 PFL Parnell Brand of Propofol Pisa Brand of Propofol Prestwick0_000931 Prestwick1_000931 Prestwick2_000931 Prestwick3_000931 Propofol Propofol (JAN/USAN/INN) Propofol Abbott Propofol Fresenius Propofol IDD-D Propofol MCT Propofol Rovi Propofol [USAN:INN:BAN] Propofol(2,6-Diisopropylphenol) Propofol-Lipuro Propofolum Propofolum [Latin] Rapinovet Recofol Rovi Brand of Propofol S01-0189 SAM002264610 SMR000059151 SPBio_003031 SPECTRUM1505022 ST50405911 Schering Brand of Propofol UNII-YI7VU623SF W505102_ALDRICH ZD-0859 ZINC00968303 Zeneca Brand of Propofol ghl.PD_Mitscher_leg0.558 nchembio.552-comp7 propofol |
| | 4 | | Rocuronium | approved | | 283 | 119302-91-9, 143558-00-3 | 441290 | (2beta,3alpha,5alpha,16beta,17beta)-17-acetoxy-16-(1-allylpyrrolidinium-1-yl)-3-hydroxy-2-(morpholin-4-yl)androstane 143558-00-3 AC1L9AWM BIDD:GT0360 C07556 CHEBI:8884 CID441290 | DB00728 Esmeron HMS2090E03 NCGC00167433-01 Rocuronium Rocuronium bromide Zemuron [(2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-16-(1-prop-2-enylpyrrolidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate | |
| | 5 | | Bupivacaine | approved, investigational | | 1233 | 2180-92-9, 38396-39-3 | 2474 | ( inverted exclamation markA)-bupivacaine (+-)-Bupivacaine (1)-1-Butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide (RS)-bupivacaine (±)-bupivacaine 1-Butyl-2',6'-pipecoloxylidide 1-Butyl-N-(2,6-dimethylphenyl)-2-piperidinecarboxamide 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide 15233-43-9 2180-92-9 38396-39-3 AB00053674 AC-2096 AC1L1DRE AC1Q5LX4 AH 250 AKOS001637202 AR-1A0242 Anekain BPBio1_000298 BRD-A01636364-003-05-2 BSPBio_000270 BSPBio_002607 Bio-0886 Bloqueina Bucaine Bucaine (TN) Bupivacaina Bupivacaina [INN-Spanish] Bupivacaine (INN) Bupivacaine Carbonate Bupivacaine HCL Bupivacaine HCL KIT Bupivacaine Monohydrochloride, Monohydrate Bupivacaine [INN:BAN] Bupivacainum Bupivacainum [INN-Latin] Bupivan C07529 C18H28N2O CBupivacaine CHEBI:3215 CHEMBL1098 CID2474 Carbostesin D07552 DB00297 DL-Bupivacaine DUR-843 | DepoBupivacaine DivK1c_000758 EINECS 218-553-3 EINECS 253-911-2 HMS2090F12 IDI1_000758 KBio1_000758 KBio2_002004 KBio2_004572 KBio2_007140 KBio3_001827 KBioGR_001516 KBioSS_002004 KST-1A4609 L000695 LAC-43 LS-109841 LS-2222 MLS001361336 Marcaina Marcaine Marcaine HCL Marcaine Spinal MolPort-004-955-820 NCGC00178579-01 NCGC00178579-02 NINDS_000758 NSC119660 Prestwick0_000305 Prestwick1_000305 Prestwick2_000305 Prestwick3_000305 SMR000058218 SPBio_001558 SPBio_002489 Sensorcaine Sensorcaine-MPF Sensorcaine-MPF Spinal Spectrum2_001589 Spectrum3_000974 Spectrum4_001098 Spectrum5_001483 Spectrum_001524 Transdur-Bupivacaine UNII-Y8335394RO Win 11318 Win 11318 HCl bupivacaine cBupivacaine dl-1-Butyl-2',6'-pipecoloxylidide racemic bupivacaine |
| | 6 | | Sevoflurane | approved, vet_approved | | 508 | 28523-86-6 | 5206 | 1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane 28523-86-6 AC-15484 AC1L1JU0 BRN 2041023 Bax 3084 C009250 C07520 C4H3F7O CHEBI:9130 CHEMBL1200694 CID5206 D00547 DB01236 F0691 Fluoromethyl 1,1,1,3,3,3-Hexafluoroisopropyl Ether Fluoromethyl 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ether I14-13357 LS-67851 MR6S4 | MR_6S4 MolPort-001-775-746 NCGC00167421-01 PC4681 Sevofluran Sevoflurane Sevoflurane (JAN/USAN/INN) Sevoflurane [USAN:INN:BAN:JAN] Sevoflurano Sevoflurano [INN-Spanish] Sevofluranum Sevofluranum [INN-Latin] Sevofrane Sevorane Sojourn UNII-38LVP0K73A Ultane Ultane (TN) ZINC01530810 fluoromethyl hexafluoroisopropyl ether fluoromethyl-2,2,2-trifluoro-1-(trifluoromethyl)ethyl ether sevoflurane |
| | 7 | | Racepinephrine | | | 985 | | | | 8 | | Epinephryl borate | | | 985 | | | | 9 | | Bromides | | | 642 | | | | 10 | | Central Nervous System Depressants | | | 13403 | | | | 11 | | Anesthetics | | | 9596 | | |
Interventional clinical trials:| id | Name | Status | NCT ID | Phase |
|---|
| 1 | Laparoscopic Versus Open Pyloromyotomy for Infants With Idiopathic Hypertrophic Pyloric Stenosis | Completed | NCT00195949 | Phase 3 | | 2 | The Effect of Hypertrophic Pyloric Stenosis (HPS) on Sodium Intake in Childhood | Unknown status | NCT01159509 | | | 3 | Spinal Anesthesia and General Anesthesia for Pyloromyotomy - Surgical Outcomes a Comparison Retrospective Study | Not yet recruiting | NCT03095144 | | | 4 | Post-operative Outcomes in the Pyloromyotomy Procedure Under Spinal Anesthesia | Not yet recruiting | NCT02879292 | |
|
