|
|
Drugs for Ureter Adenocarcinoma (from DrugBank, HMDB, Dgidb, PharmGKB, IUPHAR, NovoSeek, BitterDB): (show top 50)
(show all 61)
| id | | Name | Status | Phase | Clinical Trials | Cas Number | PubChem Id |
|---|
| 1 | | Fentanyl | approved, illicit, investigational, vet_approved | Phase 3 | 773 | 437-38-7 | 3345 | 1-Phenethyl-4-(N-phenylpropionamido)piperidine 1-Phenethyl-4-N-propionylanilinopiperidine 1-phenethyl-4-N-propionylanilinopiperidine 437-38-7 5-22-08-00049 (Beilstein Handbook Reference) 80832-90-2 990-73-8 (citrate) AC1L1FQ2 Actiq BIDD:GT0555 BRN 0494484 CHEBI:119915 CHEMBL596 CID3345 D00320 DB00813 Duragesic Duragesic (TN) Duragesic-100 Duragesic-12 Duragesic-25 Duragesic-50 Duragesic-75 Durogesic EINECS 207-113-6 Fentanest Fentanil Fentanil [DCIT] Fentanila Fentanila [INN-Spanish] Fentanilo Fentanyl Fentanyl (JAN/USAN/INN) Fentanyl CII Fentanyl [INN:BAN] Fentanyl citrate Fentanyl-100 Fentanyl-12 Fentanyl-25 | Fentanyl-50 Fentanyl-75 Fentanylum Fentanylum [INN-Latin] HSDB 3329 IONSYS JNS020QD L001275 LS-124439 Matrifen MolPort-003-847-369 N-(1-Phenethyl-4-piperidinyl)-N-phenylpropionamide N-(1-Phenethyl-4-piperidyl)propionanilide N-(1-Phenethyl-piperidin-4-yl)-N-phenyl-propionamide N-(1-Phenethylpiperidin-4-yl)-N-phenylpropionamide N-(1-phenethyl-4-piperidinyl)-N-phenylpropionamide N-(1-phenethyl-4-piperidyl)propionanilide N-(1-phenethylpiperidin-4-yl)-N-phenylpropanamide N-(1-phenethylpiperidin-4-yl)-N-phenylpropionamide N-Phenethyl-4-(N-propionylanilino)piperidine N-Phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide N-phenethyl-4-(N-propionylanilino)piperidine N-phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide NCGC00168252-01 Nasalfent Oprea1_152073 Oprea1_207148 PDSP1_000860 PDSP2_000846 Pentanyl Phentanyl Propanamide, N-phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)- (9CI) R 4263 Rapinyl Sentonil Sublimase Sublimaze UNII-UF599785JZ fentanyl | |
| | 2 | | Liver Extracts | | Phase 3, Phase 1 | 3868 | | | | 3 | | Narcotics | | Phase 3 | 3486 | | | | 4 | | pancreatic polypeptide | | Phase 3, Phase 1 | 20 | | | | 5 | | Adjuvants, Anesthesia | | Phase 3 | 1588 | | | | 6 | | Central Nervous System Depressants | | Phase 3 | 12806 | | | | 7 | | Peripheral Nervous System Agents | | Phase 3 | 22776 | | | | 8 | | Analgesics | | Phase 3 | 11287 | | | | 9 | | Analgesics, Opioid | | Phase 3 | 3091 | | | | 10 | | Anesthetics | | Phase 3 | 9001 | | | | 11 | | Anesthetics, Intravenous | | Phase 3 | 2406 | | | | 12 | | Anesthetics, General | | Phase 3 | 2787 | | | | 13 | | Cola | Nutraceutical | Phase 3, Phase 1 | 1881 | | | | 14 | | Paclitaxel | approved, vet_approved | Phase 2, Phase 1 | 2758 | 33069-62-4 | 36314 | (2AR-(2aalpha,4beta,4abeta,6beta,9alpha(alpha r*,betas*),11alpha,12alpha,12balpha))-beta-(benzoylamino)-alpha-hydroxybenzenepropanoic acid 6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca(3,4)benz(1,2-b)oxet-9-yl ester 12-benzoate, 9-ester with (2R,3S)-N-benzoyl-3-phenylisoserine 157069-30-2 33069-62-4 5beta,20-Epoxy-1,2-alpha,4,7beta,10beta,13alpha-hexahydroxytax-11-en-9-one 4,10-diacetate 2-benzoate 13-ester with (2R,3S)-N-benzoyl-3-phenylisoserine 7,11-Methano-1H-cyclodeca[3,4]benz[1,2-b]oxete, benzenepropanoic acid deriv. 7,11-Methano-5H-cyclodeca[3,4]benz[1,2-b]oxete,benzenepropanoic acid deriv. 7-Epi-Paclitaxel 7-Epi-Taxol 7-Epipaclitaxel 7-Epitaxol 7-epi-Paclitaxel 7-epi-Taxol AB00513812 ABI 007 ABI-007 ABI007 AC-675 AC1L1IOG AC1L1VJI AC1L9AVF ACon1_002231 ANX-513 Abraxane Abraxane (TN) Abraxane I.V. Suspension Abraxis BioScience brand of albumin-bound paclitaxel Ambotz33069-62-4 Anzatax Asotax BIDD:PXR0046 BMS 181339-01 BMS-181339 BMS-181339-01 BPBio1_000320 BRD-A23723433-001-01-2 BRD-A28746609-001-04-0 BRD-K62008436-001-03-1 BSPBio_000290 BSPBio_001152 BSPBio_002614 Bio-0076 Bio1_000362 Bio1_000851 Bio1_001340 Bio2_000416 Bio2_000896 Bristaxol C07394 C466458 C47H51NO14 CCRIS 8143 CHEBI:103439 CHEBI:45863 CHEMBL100910 CHEMBL418410 CHEMBL48 CID36314 CID441276 CID4666 CID6713921 CID6915727 CPD-8718 Capxol D00491 DB01229 DHP-107 DHP-208 DRG-0190 DTS-301 DivK1c_000441 EU-0101201 Ebetaxel EmPAC Epitaxol Genaxol Genetaxyl Genexol Genexol-PM HMS1362J13 HMS1568O12 HMS1792J13 HMS1922K08 HMS1990J13 HMS2090D07 HMS2093K15 HMS501G03 HSDB 6839 I06-0014 IDI1_000441 IDI1_002171 Intaxel KBio1_000441 KBio2_000492 KBio2_002016 KBio2_002509 KBio2_003060 KBio2_004584 KBio2_005077 KBio2_005628 KBio2_007152 KBio2_007645 KBio3_000903 KBio3_000904 KBio3_001834 KBio3_002987 KBioGR_000492 KBioGR_001893 | KBioGR_002509 KBioSS_000492 KBioSS_002016 KBioSS_002517 LMPR0104390001 LS-31070 LipoPac Lopac0_001201 MBT 0206 MEGxp0_001940 MLS000863266 MLS001077297 MLS002154218 MLS002172439 MLS002695976 MPI-5018 Micellar Paclitaxel Mitotax MolPort-001-742-627 MolPort-003-665-783 MolPort-003-932-365 NCGC00024995-02 NCGC00024995-03 NCGC00024995-04 NCGC00024995-05 NCGC00024995-06 NCGC00024995-07 NCGC00164367-01 NCGC00164367-02 NCGC00164367-03 NCI60_000601 NINDS_000441 NK 105 NP-010981 NSC 125973 NSC-125973 NSC125973 NSC358882 Nanotaxel Neuro_000060 Nova-12005 OAS-PAC-100 OncoGel Onxal Onxol Onxol, Taxol, Nov-Onxol, Paclitaxel P1632 Paclical Pacligel Paclitaxel Paclitaxel (JAN/USP) Paclitaxel (JAN/USP/INN) Paclitaxel (Taxol) Paclitaxel [USAN:INN:BAN] Paxceed Paxene Paxoral Plaxicel Praxel Prestwick0_000155 Prestwick1_000155 Prestwick2_000155 Prestwick3_000155 Probes2_000350 QW 8184 S-8184 Paclitaxel Injectable Emulsion S1150_Selleck SDCCGMLS-0066823.P001 SDP-013 SMP1_000228 SMR000394086 SMR000857385 SPBio_000943 SPBio_002229 SPECTRUM1503908 ST50306996 Spectrum2_000872 Spectrum3_001057 Spectrum4_001197 Spectrum5_001491 Spectrum_001536 T 7402 T1912_SIGMA T7191_SIGMA T7402_SIGMA TA1 TAXOL (TN) TAXOL, 10-EPI, TXL TaxAlbin Taxol Taxol A Taxol Konzentrat Taxol.RTM. (Registered Trademark) UNII-P88XT4IS4D UPCMLD-DP108:001 UPCMLD-DP108:002 Vascular Wrap Xorane Yewtaxan abi-007 albumin-bound paclitaxel cMAP_000068 nab-paclitaxel nchembio.188-comp1 nchembio.2007.34-comp9 nchembio.215-comp9 nchembio853-comp6 paclitaxel weekly paclitaxel |
| | 15 | | nivolumab | approved | Phase 2, Phase 1 | 326 | 946414-94-4 | | | MDX-1106 ONO-4538 nivolumab |
| | 16 | | Gemcitabine | approved | Phase 2 | 1974 | 95058-81-4 | 60750 | 103882-84-4 122111-03-9 2',2'-DiF-dC 2',2'-Difluoro-2'-deoxycytidine 2',2'-Difluorodeoxycytidine 2'-Deoxy-.beta.-D-2',2'-difluorocytidine 2'-Deoxy-2',2'-difluorocytidine 4-Amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one 4-Amino-1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl) tetrahydrofuran-2-yl]-1H-pyrimidin-2-one 4-amino-1-((2R,4R,5R)-3,3-Difluoro-4-hydroxy-5-(hydroxymethyl)-tetrahydrofuran-2-yl)pyrimidin-2(1H)-one 4-amino-1-((2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)-tetrahydrofuran-2-yl)pyrimidin-2(1H)-one 95058-81-4 AB1004842 AC1L1TUQ C07650 CCRIS 8984 CHEBI:175901 CHEMBL888 CID60750 Cytidine, 2'-deoxy-2',2'-difluoro-2'-Deoxy-.beta.-D-2',2'-difluorocytidine D02368 DB00441 DDFC DFDC DFdC DFdCyd Folfugem GEO Gamcitabine GemLip Gemcel | Gemcin Gemcitabin Gemcitabina Gemcitabina [INN-Spanish] Gemcitabine Gemcitabine (USAN/INN) Gemcitabine HCl Gemcitabine hydrochloride Gemcitabine stereoisomer Gemcitabinum Gemcitabinum [INN-Latin] Gemtro Gemzar Gemzar (hydrochloride) HMS2089P10 HSDB 7567 Inno-D07001 LS-59139 LY 188011 LY-188011 LY188011 NCGC00168784-01 NChemBio.2007.10-comp25 NSC 613327 NSC613327 TL8005979 UNII-B76N6SBZ8R ZINC18279854 Zefei gemcitabine nchembio.573-comp7 nchembio.90-comp2 | |
| | 17 | | Sorafenib | approved, investigational | Phase 2 | 692 | 284461-73-0 | 216239, 406563 | 284461-73-0 4(4-{3-[4-Chloro-3-(trifluoromethyl)phenyl]ureido}phenoxy)-N(sup 2)-methylpyridine-2-carboxamide 4-(4-((((4-Chloro-3-(trifluoromethyl)phenyl)amino)carbonyl)amino)phenoxy)-N-methyl-2-pyridinecarboxamide 4-(4-(3-(4-chloro-3-trifluoromethylphenyl)ureido)phenoxy)pyridine-2-carboxyllic acid methyamide-4-methylbenzenesulfonate 4-(4-{3-(4-Chloro-3-(trifluoromethyl)phenyl)ureido}phenoxy)-N(sup 2)-methylpyridine-2-carboxamide 4-[4-({[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methylpyridine-2-carboxamide 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methyl-pyridine-2-carboxamide 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-2-pyridinecarboxamide 4-{4-[({[4-CHLORO-3-(TRIFLUOROMETHYL)PHENYL]AMINO}CARBONYL)AMINO]PHENOXY}-N-METHYLPYRIDINE-2-CARBOXAMIDE AB1004622 AC-1674 AC1L50CF BAX BAY 43-9006 BAY 43-9006 (free base) BAY 43-9006 tosylate salt BAY 439006 BAY 54-9085 (tosylate salt) BAY-43-0006 BAY-43-9006 BAY-54-9085 BAY43-9006 BRD-K23984367-001-01-8 Bio-0100 CHEBI:47228 CHEBI:50924 CHEMBL1336 CID216239 | D08524 DB00398 DB07438 EN002709 I06-0856 K00597a Kinome_766 LS-186067 LS-187021 LS-187788 MolPort-003-850-270 N-(4-Chloro-3-(trifluoromethyl)phenyl)-N'-(4-(2-(N-methylcarbamoyl)-4-pyridyloxy)phenyl)urea N-(4-Chloro-3-(trifluoromethyl)phenyl)-n'-(4-(2-(N-methylcarbamoyl)-4-pyridyloxy)phenyl)urea N-(4-chloro-3-(trifluoromethyl)phenyl)-N'-(4-(2-(N-methylcar bamoyl)-4-pyridyloxy)phenyl)urea N-[4-Chloro-3-(trifluoromethyl)phenyl]-N'-[4-[2-(N-methylcarbamoyl)-4-pyridyloxy]phenyl]urea NCGC00167488-01 NSC-724772 NSC747971 Nexavar STK627350 Sorafenib Sorafenib (INN) Sorafenib [INN] Sorafenib tosylate Sorafenibum UNII-9ZOQ3TZI87 ZINC01493878 nchembio.117-comp17 sorafenib sorafenibum | |
| | 18 | | Folic Acid | approved, nutraceutical, vet_approved | Phase 2 | 4279 | 59-30-3 | 6037 | (2S)-2-[[4-[(2-amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid 01769_FLUKA 2d0k 33609-88-0 36653-55-1 (mono-potassium salt) 59-30-3 6484-89-5 (mono-hydrochloride salt) AC-11682 AC1L1LNX AI3-26387 AKOS000503224 ARONIS014410 Acfol (Spain) Acide folique Acide folique [INN-French] Acido folico Acido folico [INN-Spanish] Acidum folicum Acidum folicum [INN-Latin] Acifolic Antianemia factor Apo-Folic BIDD:ER0563 BIDD:GT0641 BIF0608 BPBio1_000654 BSPBio_000594 BSPBio_002338 C00504 C20H20N6O6 CAS-59-30-3 CCRIS 666 CHEBI:27470 CHEMBL1622 CID6037 CPD000471860 Cytofol D00070 DB00158 DivK1c_000494 Dosfolat B activ EINECS 200-419-0 F0043 F7876_SIAL F7876_SIGMA F8758_SIGMA F8798_SIAL F8890_SIGMA FOL Facid Factor U Folacid Folacin Folaemin Folaemin [Netherlands] Folan Folasic (Australia) Folate Folbal Folcidin Folcidin (VAN) Folcysteine Foldine Foldine [France] Folettes Foliamin Folic Folic acid Folic acid (JP15/USP/INN) Folic acid (TN) Folic acid [BAN:INN:JAN] Folic acid [INN:BAN:JAN] Folic acid dihydrate Folicet Folicet (TN) Folico Folico (Italy) Folina Folina (Italy) Folipac Folsaeure | Folsan Folsaure Folsav Folvite Folvron Glutamic acid, N-(p-(((2-amino-4-hydroxypyrimido(4,5-b)pyrazin-6-yl)methyl)amino)benzoyl)-, L HMS1921D20 HMS2092N17 HMS501I16 HSDB 2002 IDI1_000494 InChI=1/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s Incafolic KBio1_000494 KBio2_001861 KBio2_004429 KBio2_006997 KBio3_001558 KBioGR_002222 KBioSS_001861 Kyselina listova Kyselina listova [Czech] LS-2157 Liver Lactobacillus casei factor MLS001304016 MLS001335861 Millafol Mission prenatal Mittafol MolPort-004-285-551 N-(4-(((2-Amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl)amino)benzo- yl)-L-glutamic acid N-(4-((2-Amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl)amino)benzoyl)-L-glutamic acid N-(4-{[(2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid N-(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid N-(p-(((2-Amino-4-hydroxy-6-pteridinyl)methyl)amino)benzoyl)-L-glutamic acid N-Pteroyl-L-glutamic acid N-[(4-{[(2-Amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-glutamic acid NCGC00016265-01 NCGC00142391-01 NINDS_000494 NSC 3073 Nifolin Nifolin [Denmark] Novofolacid Novofolacid [Canada] PGA PGA (VAN) Prestwick3_000627 Prestwick_230 PteGlu Pteroyl-L-glutamate Pteroyl-L-glutamic acid Pteroyl-L-monoglutamate Pteroyl-L-monoglutamic acid Pteroylglutamate Pteroylglutamic acid Pteroylmonoglutamate Pteroylmonoglutamic acid SAM002264616 SDCCGMLS-0066738.P001 SMP2_000137 SMR000471860 SPBio_001357 SPECTRUM1502020 Serum Folate Level Spectrum2_001459 Spectrum3_000749 Spectrum4_001751 Spectrum5_000602 Spectrum_001381 UNII-935E97BOY8 Usaf cb-13 Vitamin B11 Vitamin B9 Vitamin Bc Vitamin Be Vitamin M bmse000299 folic acid nchembio.108-comp10 | |
| | 19 | | Nicotinamide | approved, Nutraceutical | Phase 2 | 902 | 98-92-0 | 936 | .beta.-Pyridinecarboxamide 11032-50-1 123574-63-0 1yc5 3 Pyridinecarboxamide 3-Carbamoylpyridine 3-Pyridinecarboxamide 3-Pyridinecarboxylic acid amide 37321-14-5 47865U_SUPELCO 55600-01-6 63748-44-7 72340_FLUKA 72340_SIGMA 72347_FLUKA 78731-47-2 98-92-0 A186B02E-6C70-4E54-9739-79398D439AAA AC-907/25014114 AC1L1ACZ AC1Q4ZFV AI3-02906 Acid amide Amid kyseliny nikotinove Amid kyseliny nikotinove [Czech] Amide PP Aminicotin Amixicotyn Amnicotin Astra Brand of Niacinamide Austrovit PP B 3, Vitamin B3, Vitamin BB_NC-2290 Benicot C00153 C6H6N2O CCRIS 1901 CHEBI:17154 CHEMBL1140 CID936 CPD000058212 D00036 D009536 DB02701 DEA No. 1405 Delonin Amide Delonin amide Dipegyl Dipigyl EINECS 202-713-4 EINECS 234-265-0 Endobion Enduramide Factor pp HMS2052M21 HMS2090B05 HMS2093H03 HSDB 1237 Hansamid I02-1741 I02-2250 InChI=1/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9 Inovitan PP Jenapharm Brand of Niacinamide Jenapharm, Nicotinsaureamid LS-2051 MLS000069714 Mediatric Merck Brand of Niacinamide MolMap_000061 MolPort-001-783-876 N0078 N0636_SIGMA N2142_SIGMA N3376_SIGMA N5535_SIAL NAM NCGC00093354-03 NCGC00093354-04 NSC 13128 NSC13128 NSC27452 Nandervit-N Niacevit Niacinamide Niacinamide (USP) Niacinamide Astra Brand Niacinamide Jenapharm Brand Niacinamide Merck Brand | Niacinamide Pharmagenix Brand Niacinamide [USAN] Niacinamide, Nicotinic acid amide, Nicotinamide Niacotinamide Niamide Niavit PP Nicamide Nicamina Nicamindon Nicasir Nicobion Nicofort Nicogen Nicomidol Nicosan 2 Nicosylamide Nicota Nicotamide Nicotilamide Nicotililamido Nicotinamid Nicotinamida Nicotinamida [INN-Spanish] Nicotinamide Nicotinamide (JP15/INN) Nicotinamide (Niacinamide) Nicotinamide, niacin, vitamin B3 Nicotinamide-carbonyl-14C Nicotinamidum Nicotinamidum [INN-Latin] Nicotine acid amide Nicotine amide Nicotinic acid amide Nicotinic amide Nicotinsaeureamid Nicotinsaureamid Nicotinsaureamid Jenapharm Nicotinsaureamid [German] Nicotol Nicotylamide Nicotylamidum Nicovel Nicovit Nicovitina Nicovitol Nicozymin Nictoamide Nikasan Nikazan Niko-tamin Nikotinamid Nikotinsaeureamid Nikotinsaeureamid [German] Niocinamide Niozymin PP-Faktor Papulex Pelmin Pelmine Pelonin amide Pharmagenix Brand of Niacinamide Propamine A Pyridine-3-carboxylic acid amide S1899_Selleck SAM001246860 SGCUT00176 SMR000058212 Savacotyl UNII-25X51I8RD4 Vi-Nicotyl Vi-noctyl Vitamin B Vitamin B (VAN) Vitamin B 3 Vitamin B3 amide Vitamin H1 Vitamin PP WLN: T6NJ CVZ Witamina PP ZINC00005878 b-Pyridinecarboxamide beta-Pyridinecarboxamide bmse000281 m-(Aminocarbonyl)pyridine nchembio.154-comp4 nchembio.73-comp6 niacin - Vitamin B3 niacinamide nicotinamide pyridine-3-carboxamide to_000073 vitamin PP |
| | 20 | | Niacin | approved, investigational, nutraceutical | Phase 2 | 906 | 59-67-6 | 938 | 3-Carboxylpyridine 3-Carboxypyridine 3-Pyridinecarboxylate 3-Pyridinecarboxylic acid 3-Pyridylcarboxylate 3-Pyridylcarboxylic acid 3-carboxypyridine Acide Nicotinique Acido nicotinico Acidum Nicotinicum Akotin Anti-pellagra vitamin Apelagrin Daskil Efacin Enduracin Linic M-Pyridinecarboxylic Acid Niac Niacin Niacine Niacor Nicacid Nicamin Nicangin | Nico-Span Nicobid Nicocap Nicodelmine Nicolar Niconacid Nicosan 3 Nicotinate Nicotinic Acid Nicotinic acid Nicotinipca Nicyl Nikotinsaeure Nyclin P.P. factor PP Factor Pellagra preventive factor Pellagrin Pelonin Pyridine-beta-carboxylic acid Slo-niacin Vitamin B3 Wampocap beta-Pyridinecarboxylic acid pyridine-β-carboxylic acid β-pyridinecarboxylic acid | |
| | 21 | | Camptothecin | experimental | Phase 2 | 699 | 7689-03-4 | | (+)-camptothecin (+)-camptothecine (s)-(+)-camptothecin | (s)-camptothecin 20(S)-Camptothecin 21,22-Secocamptothecin-21-oic acid lactone Camptothecine D-camptothecin |
| | 22 | | Albumin-Bound Paclitaxel | | Phase 2, Phase 1 | 2757 | | | | 23 | | Antineoplastic Agents, Phytogenic | | Phase 2, Phase 1 | 5420 | | | | 24 | | Immunosuppressive Agents | | Phase 2, Phase 1 | 12770 | | | | 25 | | Antimitotic Agents | | Phase 2, Phase 1 | 5498 | | | | 26 | | Anti-Infective Agents | | Phase 2, Phase 1 | 21402 | | | | 27 | | Topoisomerase Inhibitors | | Phase 2 | 4945 | | | | 28 | | Rubitecan | | Phase 2 | 24 | | | | 29 | | Folic Acid Antagonists | | Phase 2 | 2200 | | | | 30 | | Vitamin B Complex | | Phase 2 | 4229 | | | | 31 | | Piritrexim | | Phase 2 | 1 | | | | 32 | | topoisomerase I inhibitors | | Phase 2 | 1328 | | | | 33 | | Immunoglobulins | | Phase 2, Phase 1 | 6045 | | | | 34 | | Antibodies | | Phase 2, Phase 1 | 6045 | | | | 35 | | Antibodies, Monoclonal | | Phase 2, Phase 1 | 3795 | | | | 36 | | Vitamins | | Phase 2 | 5095 | | | | 37 | | Nicotinic Acids | | Phase 2 | 906 | | | | 38 | | Trace Elements | | Phase 2 | 5802 | | | | 39 | | Micronutrients | | Phase 2 | 5802 | | | | 40 | | Protein Kinase Inhibitors | | Phase 2 | 3612 | | | | 41 | | Antimetabolites | | Phase 2 | 11774 | | | | 42 | | Antiviral Agents | | Phase 2 | 9732 | | | | 43 | | Antimetabolites, Antineoplastic | | Phase 2 | 7171 | | | | 44 | | Folinic Acid | Nutraceutical | Phase 2 | 3150 | | | | 45 | | Vitamin B9 | Nutraceutical | Phase 2 | 4279 | | | | 46 | | Folate | Nutraceutical | Phase 2 | 4279 | | | | 47 | | tyrosine | Nutraceutical | Phase 2 | 659 | | | | 48 | | Vitamin B3 | Nutraceutical | Phase 2 | 906 | | | | 49 | | Trastuzumab | approved, investigational | Phase 1 | 766 | 180288-69-1 | 9903 | 180288-69-1 Anti HER2 Anti-erbB2 Monoclonal Antibody D03257 HER2 Monoclonal Antibody Herceptin | Herceptin (TN) Ig gamma-1 chain C region Trastuzumab Trastuzumab (INN) Trastuzumab (genetical recombination) Trastuzumab (genetical recombination) (JAN) trastuzumab | |
| | 50 | | Carboplatin | approved | Phase 1 | 1980 | 41575-94-4 | 10339178, 498142, 38904 | (SP-4-2)-diammine[cyclobutane-1,1-dicarboxylato(2-)-kappa(2)O,O']platinum /h1-3H2,(H,7,8)(H,9,10) /q 1,1-Cyclobutanedicarboxylate diammine platinum (II) 1,1-Cyclobutanedicarboxylate diammine platinum(II) 2*-1 2*1H2 41575-94-4 70903-55-8 AC-1457 AC1L8I6U Ambap41575-94-4 BSPBio_003145 C 2538 C2043 C2538_SIGMA C6H10N2O4Pt CBDCA CCRIS 3404 CHEBI:31355 CHEMBL1351 CHEMBL288376 CID10339178 CID2567 CID38904 CID426756 CID498142 CID5352133 CID6398587 CID6603770 Carbopaltin Carboplatin Carboplatin (JAN/USP/INN) Carboplatin (USAN) Carboplatin [USAN:INN:BAN:JAN] Carboplatine Carboplatine [French] Carboplatino Carboplatino [Spanish] Carboplatinum Carboplatinum [Latin] Cbdca Cyclobutane-1,1-dicarboxylate D01363 DB00958 Diammine(1,1-cyclobutanedicarboxylato)platinum (II) Diammine(cyclobutane-1,1-dicarboxylato(2-)-O,O')platinum Diammine-1,1-cyclobutane dicarboxylate platinum II DivK1c_000892 EINECS 255-446-0 EU-0100230 Ercar HMS1921J16 HMS2090M05 HMS2092B22 HMS502M14 HSDB 6957 I14-2390 IDI1_000892 IUPAC: Azane InChI=1/C6H8O4.2H2N.Pt/c7-4(8)6(5(9)10)2-1-3-6 | JM 8 JM-8 KBio1_000892 KBio2_002009 KBio2_004577 KBio2_007145 KBio3_002645 KBioGR_000713 KBioSS_002009 LS-117689 Lopac-C-2538 Lopac0_000230 MolPort-003-665-501 MolPort-003-845-609 NCGC00015223-01 NCGC00093695-01 NCGC00094961-01 NCGC00094961-02 NCGC00094961-03 NCGC00162099-01 NCGC00162099-02 NCGC00167800-01 NCGC00178242-01 NINDS_000892 NSC 201345 NSC 241240 NSC-241240 NSC201345 NSC241240 Paraplatin Paraplatin (TN) Paraplatin, Carboplatin Paraplatin-AQ Platinum(+2) Cation Platinum(II), (1, 1-cyclobutanedicar Platinum, diammine(1,1-cyclobutanedicarboxylato(2-)-O,O')-, (SP-4-2) Platinum, {diammine[1,1-cyclobut S1215_Selleck SPBio_000716 SPECTRUM1502106 Spectrum2_000898 Spectrum3_001503 Spectrum4_000337 Spectrum5_001094 Spectrum_001529 UNII-BG3F62OND5 azanide carboplatin cis -Diammine[1,1-cyclobutane-dicarboxylato] platinum cis-(1,1-Cyclobutanedicarboxylato)diammineplatinum(II) cis-(1,1-Cyclobutanedicarboxylato)diammineplatinum(ii) cis-Diamine(1,1-cyclobutanedicarboxylato)platinum(II) cis-Diamine[1,1-cyclobutanedicarboxylato]platinum(II) cis-Diammine(1,1-cyclobutanedicarboxylato) platinum cis-Diammine(1,1-cyclobutanedicarboxylato)platinum cis-Diammine(1,1-cyclobutanedicarboxylato)platinum(II) cis-Diammine(cyclobutanedicarboxylato)platinum II cyclobutane-1,1-dicarboxylic acid diammine[cyclobutane-1,1-dicarboxylato(2-)-k2O1,O1]platinum nchembio.573-comp10 nchembio773-comp2 nchembio873-comp3 platinum(2+) |
|
Interventional clinical trials: (show all 20)
| id | Name | Status | NCT ID | Phase |
|---|
| 1 | Fentanyl Sublingual Spray in Treating Patients With Breakthrough Cancer Pain | Completed | NCT00538850 | Phase 3 | | 2 | Antineoplaston Therapy in Treating Patients With Stage IV Kidney Cancer | Unknown status | NCT00003520 | Phase 2 | | 3 | Piritrexim in Treating Patients With Advanced Cancer of the Urinary Tract | Completed | NCT00002914 | Phase 2 | | 4 | Nitrocamptothecin in Treating Patients With Metastatic Cancer of the Urinary Tract | Completed | NCT00006026 | Phase 2 | | 5 | VEGF Trap in Treating Patients With Recurrent, Locally Advanced, or Metastatic Cancer of the Urothelium | Completed | NCT00407485 | Phase 2 | | 6 | Nivolumab and Ipilimumab in Treating Patients With Rare Tumors | Recruiting | NCT02834013 | Phase 2 | | 7 | Cabozantinib for Advanced Urothelial Cancer | Active, not recruiting | NCT01688999 | Phase 2 | | 8 | MGCD516 Combined With Nivolumab in Renal Cell Cancer (RCC) | Not yet recruiting | NCT03015740 | Phase 1, Phase 2 | | 9 | S0028, Gemcitabine and Paclitaxel in Treating Patients With Advanced or Recurrent Cancer of the Urinary Tract | Terminated | NCT00022633 | Phase 2 | | 10 | Sorafenib in Treating Patients With Regional or Metastatic Cancer of the Urothelium | Terminated | NCT00112905 | Phase 2 | | 11 | Interleukin-12 and Trastuzumab in Treating Patients With Cancer That Has High Levels of HER2/Neu | Completed | NCT00004074 | Phase 1 | | 12 | Thalidomide and Docetaxel in Treating Patients With Advanced Cancer | Completed | NCT00049296 | Phase 1 | | 13 | Trastuzumab Plus R115777 in Treating Patients With Advanced or Metastatic Cancer | Completed | NCT00005842 | Phase 1 | | 14 | A Study of Ramucirumab Plus Pembrolizumab in Participants With Gastric or GEJ Adenocarcinoma, NSCLC, Transitional Cell Carcinoma of the Urothelium, or Biliary Tract Cancer | Recruiting | NCT02443324 | Phase 1 | | 15 | Study of Genes and Environment in Patients With Cancer in East Anglia, Trent, or West Midlands Regions of the United Kingdom | Unknown status | NCT00757614 | | | 16 | Biomarkers in Patients With Kidney Cancer or Cancer of the Urothelium and in Healthy Participants | Completed | NCT00900276 | | | 17 | Postoperative Telerounding: A Multi-Center Prospective Randomized Assessment of Patient Outcomes and Satisfaction. | Completed | NCT00263107 | | | 18 | Early Intervention vs. Standard Palliative Care in Improving End-of-Life Care in Advanced Cancer Patients | Completed | NCT00253383 | | | 19 | Family Caregiver Palliative Care Intervention in Supporting Caregivers of Patients With Stage II-IV Gastrointestinal, Gynecologic, and Urologic Cancers | Recruiting | NCT01846520 | | | 20 | Cancer Research Repository for Individuals With Cancer Diagnosis, High Risk Individuals, and Individuals With No History of Cancer (Control) | Recruiting | NCT02012699 | |
|
